CAS 7335-59-3
:2-acetyl-3-nitrobenzoic acid
Description:
2-Acetyl-3-nitrobenzoic acid, with the CAS number 7335-59-3, is an organic compound that features both an acetyl group and a nitro group attached to a benzoic acid structure. This compound typically appears as a crystalline solid and is characterized by its aromatic nature due to the benzene ring. The presence of the nitro group introduces significant polarity and can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The acetyl group contributes to its functionality, allowing for potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, the compound exhibits acidic properties due to the carboxylic acid group, which can participate in acid-base reactions. Its solubility is generally moderate in organic solvents, and it may have limited solubility in water. Overall, 2-acetyl-3-nitrobenzoic acid is a versatile compound with applications in research and industry, particularly in the fields of organic chemistry and materials science.
Formula:C9H7NO5
InChI:InChI=1/C9H7NO5/c1-5(11)8-6(9(12)13)3-2-4-7(8)10(14)15/h2-4H,1H3,(H,12,13)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.