CymitQuimica logo

CAS 73356-67-9

:

4-methyl-N-[3-(piperidin-1-yl)propyl]-6-(trifluoromethyl)-4H-furo[3,2-b]indole-2-carboxamide

Description:
4-methyl-N-[3-(piperidin-1-yl)propyl]-6-(trifluoromethyl)-4H-furo[3,2-b]indole-2-carboxamide is a synthetic organic compound characterized by its complex structure, which includes a furoindole framework, a trifluoromethyl group, and a piperidine moiety. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of the trifluoromethyl group and the indole structure, which can influence its solubility and permeability. The piperidine ring contributes to its potential biological activity, often enhancing interactions with biological targets. The presence of the carboxamide functional group may also impart hydrogen bonding capabilities, affecting its pharmacokinetic properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, where it may exhibit activity against specific biological pathways or targets. As with many synthetic compounds, its stability, reactivity, and biological effects would be influenced by its molecular structure and the functional groups present.
Formula:C21H24F3N3O2
InChI:InChI=1/C21H24F3N3O2/c1-26-16-12-14(21(22,23)24)6-7-15(16)19-17(26)13-18(29-19)20(28)25-8-5-11-27-9-3-2-4-10-27/h6-7,12-13H,2-5,8-11H2,1H3,(H,25,28)
SMILES:Cn1c2cc(ccc2c2c1cc(C(=O)NCCCN1CCCCC1)o2)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.