CAS 7336-51-8

2-acetamido-4-methylthiazole

Description:

2-Acetamido-4-methylthiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features an acetamido group (-C(=O)NH2) and a methyl group (-CH3) attached to the thiazole ring, contributing to its unique properties. It is typically a white to off-white solid and is soluble in polar solvents, which is common for compounds containing amide functionalities. The presence of the thiazole ring imparts biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, and it may exhibit antimicrobial or antifungal properties. The compound is often used in the synthesis of other chemical entities and may serve as an intermediate in various organic reactions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.

Formula: C₆H₈N₂OS

InChI: InChI=1/C6H8N2OS/c1-4-3-10-6(7-4)8-5(2)9/h3H,1-2H3,(H,7,8,9)

SMILES: Cc1csc(n1)N=C(C)O

Synonyms:

• N-(4-methyl-1,3-thiazol-2-yl)acetamide

N-(4-Methylthiazol-2-yl)acetamide

CAS: 7336-51-8

Formula: C₆H₈N₂OS

Purity: 95%

Color and Shape: Solid

Molecular weight: 156.2055

Ref: IN-DA003SD6

2-Acetamido-4-methylthiazole

CAS: 7336-51-8

2-Acetamido-4-methylthiazole

Purity: 98%

Molecular weight: 156.21g/mol

Ref: 54-OR75125

N-(4-Methylthiazol-2-yl)acetamide

CAS: 7336-51-8

Formula: C₆H₈N₂OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 156.2

Ref: 10-F209198

Alpelisib Impurity 5

CAS: 7336-51-8

Formula: C₆H₈N₂OS

Molecular weight: 156.2

Ref: ST-EA-CP-A74005