CAS 73364-11-1

Dichlorobis[(1,2,3,4,5-η)-1-ethyl-3-methyl-2,4-cyclopentadien-1-yl]zirconium

Description:

Dichlorobis[(1,2,3,4,5-η)-1-ethyl-3-methyl-2,4-cyclopentadien-1-yl]zirconium, with the CAS number 73364-11-1, is a transition metal complex featuring zirconium as the central metal atom. This compound is characterized by its coordination with two dichloro ligands and two cyclopentadienyl ligands, which are substituted with ethyl and methyl groups. The presence of these substituents contributes to the steric and electronic properties of the complex, influencing its reactivity and stability. Typically, such zirconium complexes are utilized in organometallic chemistry and catalysis, particularly in polymerization processes. The compound exhibits a distinctive geometry due to the η5 coordination of the cyclopentadienyl ligands, which can lead to interesting catalytic behaviors. Additionally, its dichloro substituents can participate in further chemical reactions, making it a versatile intermediate in synthetic applications. Overall, this compound exemplifies the rich chemistry associated with transition metal complexes and their potential utility in various chemical transformations.

Formula: C₁₆H₂₂Cl₂Zr

InChI: InChI=1S/2C8H11.2ClH.Zr/c2*1-3-8-5-4-7(2)6-8;;;/h2*4-6H,3H2,1-2H3;2*1H;/q2*-1;;;+4/p-2

InChI key: InChIKey=ODWPZWBDYAPIRY-UHFFFAOYSA-L

SMILES: [Cl-][Zr+4]12345678([Cl-])([C-]9(CC)[CH]1=C2(C)[CH]3=[CH]49)[C-]%10(CC)[CH]5=C6(C)[CH]7=[CH]8%10

Synonyms:

• Zirconium, dichlorobis[(1,2,3,4,5-η)-1-ethyl-3-methyl-2,4-cyclopentadien-1-yl]-
• Dichlorobis[(1,2,3,4,5-η)-1-ethyl-3-methyl-2,4-cyclopentadien-1-yl]zirconium
• Bis(1-methyl-3-ethylcyclopentadienyl)zirconium dichloride
• 1,3-Cyclopentadiene, 1-ethyl-3-methyl-, zirconium complex
• Bis(1-ethyl-3-methylcyclopentadienyl)zirconium dichloride