CAS 73365-94-3

4,27-dihydroxy-3-methoxy-5,6:22,26-diepoxyergost-24-ene-1,26-dione

Description:

4,27-Dihydroxy-3-methoxy-5,6:22,26-diepoxyergost-24-ene-1,26-dione, with the CAS number 73365-94-3, is a complex organic compound belonging to the class of sterols, specifically a derivative of ergosterol. This substance features multiple functional groups, including hydroxyl (-OH) and methoxy (-OCH3) groups, as well as epoxy groups, which contribute to its reactivity and biological activity. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of antifungal agents or other therapeutic compounds. The compound's structure indicates a steroid backbone, which is characteristic of many biologically active molecules. Its unique arrangement of double bonds and functional groups may influence its solubility, stability, and interaction with biological targets. As with many sterols, it may play a role in cellular processes, including membrane fluidity and signaling pathways. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmacology and biochemistry.

Formula: C₂₉H₄₂O₇

InChI: InChI=1/C29H42O7/c1-14-10-21(35-26(33)17(14)13-30)15(2)18-6-7-19-16-11-24-29(36-24)25(32)22(34-5)12-23(31)28(29,4)20(16)8-9-27(18,19)3/h15-16,18-22,24-25,30,32H,6-13H2,1-5H3

SMILES: CC1=C(CO)C(=O)OC(C1)C(C)C1CCC2C3CC4C5(C(C(CC(=O)C5(C)C3CCC12C)OC)O)O4

3β-Methoxy-2,3-dihydrowithaferin A

CAS: 73365-94-3

3beta-Methoxy-2,3-dihydrowithaferin A has cytoprotective activity, it protects normal cells against stress.

Formula: C₂₉H₄₂O₇

Purity: 99.98%

Color and Shape: Solid

Molecular weight: 502.648

Ref: TM-TN1269

3β-Methoxy-2,3-dihydrowithaferin A

CAS: 73365-94-3

Formula: C₂₉H₄₂O₇

Purity: 95%~99%

Molecular weight: 502.648

Ref: BP-BP5319

3β-Methoxy-2,3-dihydrowithaferin A

CAS: 73365-94-3

3Beta-Methoxy-2,3-dihydrowithaferin A is a synthetic withanolide, which is a type of steroidal lactone derived from the withanolide class of compounds. These compounds are primarily sourced from plants in the Solanaceae family, such as *Withania somnifera*, commonly known as Ashwagandha. The mode of action of this synthetic analogue involves mimicking the biological activities of natural withanolides, which include modulating signaling pathways and inducing apoptosis in cancer cells. The compound achieves its effects by interacting with molecular targets such as heat shock proteins and NF-κB pathways, leading to anti-inflammatory and anticancer activities.

Formula: C₂₉H₄₂O₇

Purity: Min. 95%

Molecular weight: 502.60 g/mol

Ref: 3D-YCA36594