CymitQuimica logo

CAS 733740-08-4

:

(1R,2S)-2-(4-methoxybenzoyl)cyclopentane-1-carboxylic acid

Description:
The chemical substance known as (1R,2S)-2-(4-methoxybenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 733740-08-4, is a chiral compound characterized by its cyclopentane core structure, which is substituted with a 4-methoxybenzoyl group and a carboxylic acid functional group. This compound exhibits specific stereochemistry, indicated by the (1R,2S) configuration, which influences its biological activity and interactions. The presence of the methoxy group enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. The carboxylic acid moiety contributes to its acidity and can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Such compounds are often of interest in medicinal chemistry due to their potential therapeutic applications, particularly in the development of pharmaceuticals. The unique structural features and stereochemistry of this compound may also play a significant role in its pharmacokinetics and pharmacodynamics, making it a subject of study in drug design and development.
Formula:C14H16O4
InChI:InChI=1/C14H16O4/c1-18-10-7-5-9(6-8-10)13(15)11-3-2-4-12(11)14(16)17/h5-8,11-12H,2-4H2,1H3,(H,16,17)/t11-,12+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.