CAS 733740-11-9

(1R,2S)-2-(2-ethylbenzoyl)cyclopentane-1-carboxylic acid

Description:

The chemical substance known as (1R,2S)-2-(2-ethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 733740-11-9, is a chiral compound characterized by its cyclopentane ring structure, which is substituted with a carboxylic acid group and an ethylbenzoyl moiety. This compound exhibits specific stereochemistry, indicated by the (1R,2S) configuration, which influences its reactivity and interactions in biological systems. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may form salts or esters. Additionally, the aromatic ethylbenzoyl group contributes to the compound's hydrophobic characteristics, potentially affecting its solubility and permeability in various environments. Such compounds may have applications in pharmaceuticals or as intermediates in organic synthesis, where their stereochemical properties can be crucial for biological activity. Overall, the unique structural features of this compound make it of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₅H₁₈O₃

InChI: InChI=1/C15H18O3/c1-2-10-6-3-4-7-11(10)14(16)12-8-5-9-13(12)15(17)18/h3-4,6-7,12-13H,2,5,8-9H2,1H3,(H,17,18)/t12-,13+/m0/s1