CAS 733740-12-0

rel-(1R,2S)-2-(4-Ethylbenzoyl)cyclopentanecarboxylic acid

Description:

Rel-(1R,2S)-2-(4-Ethylbenzoyl)cyclopentanecarboxylic acid is a chiral compound characterized by its specific stereochemistry, indicated by the (1R,2S) configuration. This compound features a cyclopentane ring substituted with a carboxylic acid group and a 4-ethylbenzoyl moiety, which contributes to its unique chemical properties. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions, while the aromatic ethylbenzoyl group may enhance its hydrophobic characteristics and influence its solubility in organic solvents. The compound's chirality can affect its biological activity and interactions with other molecules, making it of interest in pharmaceutical applications. Additionally, its molecular structure may allow for various synthetic modifications, potentially leading to derivatives with altered properties. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly in the context of drug design and development.

Formula: C₁₅H₁₈O₃

InChI: InChI=1/C15H18O3/c1-2-10-6-8-11(9-7-10)14(16)12-4-3-5-13(12)15(17)18/h6-9,12-13H,2-5H2,1H3,(H,17,18)/t12-,13+/s2

InChI key: InChIKey=HGHVZZVSKMIYNN-QWAQRTLVNA-N

SMILES: C(=O)([C@H]1[C@@H](C(O)=O)CCC1)C2=CC=C(CC)C=C2

Synonyms:

• Cyclopentanecarboxylic acid, 2-(4-ethylbenzoyl)-, (1R,2S)-rel-
• rel-(1R,2S)-2-(4-Ethylbenzoyl)cyclopentanecarboxylic acid