CymitQuimica logo

CAS 733740-13-1

:

(1R,2S)-2-(3-chlorobenzoyl)cyclopentane-1-carboxylic acid

Description:
The chemical substance known as (1R,2S)-2-(3-chlorobenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 733740-13-1, is characterized by its specific stereochemistry and functional groups. This compound features a cyclopentane ring, which contributes to its cyclic structure, and a carboxylic acid group that imparts acidic properties. The presence of a 3-chlorobenzoyl moiety indicates that it has a chlorinated aromatic ring attached to the cyclopentane, which can influence its reactivity and interactions with other molecules. The stereochemical configuration (1R,2S) suggests that the compound has specific spatial arrangements of its atoms, which can affect its biological activity and physical properties. Generally, compounds like this may exhibit unique solubility characteristics, melting and boiling points, and potential applications in pharmaceuticals or organic synthesis due to their structural complexity. Understanding these characteristics is essential for predicting the behavior of the compound in various chemical environments.
Formula:C13H13ClO3
InChI:InChI=1/C13H13ClO3/c14-9-4-1-3-8(7-9)12(15)10-5-2-6-11(10)13(16)17/h1,3-4,7,10-11H,2,5-6H2,(H,16,17)/t10-,11+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.