CAS 733740-14-2

(1R,2S)-2-(4-chlorobenzoyl)cyclopentane-1-carboxylic acid

Description:

The chemical substance known as (1R,2S)-2-(4-chlorobenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 733740-14-2, is a chiral compound featuring a cyclopentane ring substituted with a carboxylic acid and a 4-chlorobenzoyl group. Its structure indicates that it possesses both hydrophobic and hydrophilic characteristics, which can influence its solubility in various solvents. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions, potentially forming salts or esters. The 4-chlorobenzoyl moiety adds to its molecular complexity and may enhance its biological activity or interaction with specific receptors. This compound may be of interest in pharmaceutical research due to its chiral nature, which can affect its pharmacokinetics and pharmacodynamics. Additionally, the chlorobenzoyl group may impart unique electronic properties, influencing reactivity and stability. Overall, this compound's characteristics make it a subject of interest in organic synthesis and medicinal chemistry.

Formula: C₁₃H₁₃ClO₃

InChI: InChI=1/C13H13ClO3/c14-9-6-4-8(5-7-9)12(15)10-2-1-3-11(10)13(16)17/h4-7,10-11H,1-3H2,(H,16,17)/t10-,11+/m0/s1