CAS 733740-17-5

(1R,2S)-2-(2,3-dimethylbenzoyl)cyclopentane-1-carboxylic acid

Description:

The chemical substance known as (1R,2S)-2-(2,3-dimethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 733740-17-5, is a chiral compound characterized by its cyclopentane core and a carboxylic acid functional group. The presence of the 2,3-dimethylbenzoyl moiety indicates that it has a significant aromatic character, which can influence its reactivity and solubility. The specific stereochemistry, denoted by the (1R,2S) configuration, suggests that the compound exhibits optical activity, making it relevant in asymmetric synthesis and pharmaceutical applications. This compound may exhibit moderate to high lipophilicity due to the aromatic substituent, which can affect its biological activity and interaction with biological membranes. Additionally, the carboxylic acid group contributes to its acidity and potential for forming hydrogen bonds, which can enhance solubility in polar solvents. Overall, this compound's unique structural features make it of interest in various fields, including medicinal chemistry and materials science.

Formula: C₁₅H₁₈O₃

InChI: InChI=1/C15H18O3/c1-9-5-3-6-11(10(9)2)14(16)12-7-4-8-13(12)15(17)18/h3,5-6,12-13H,4,7-8H2,1-2H3,(H,17,18)/t12-,13+/m0/s1