CAS 733740-18-6

(1R,2S)-2-(2,4-dimethylbenzoyl)cyclopentane-1-carboxylic acid

Description:

The chemical substance known as (1R,2S)-2-(2,4-dimethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 733740-18-6, is a chiral compound characterized by its cyclopentane core structure, which is substituted with a carboxylic acid group and a 2,4-dimethylbenzoyl moiety. This compound exhibits specific stereochemistry, indicated by the (1R,2S) configuration, which influences its reactivity and interactions in biological systems. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The dimethylbenzoyl substituent contributes to the compound's hydrophobic characteristics, potentially affecting its biological activity and pharmacokinetics. Additionally, the compound may exhibit unique optical properties due to its chirality, making it of interest in fields such as medicinal chemistry and drug design. Overall, its structural features suggest potential applications in pharmaceuticals or as a synthetic intermediate in organic chemistry.

Formula: C₁₅H₁₈O₃

InChI: InChI=1/C15H18O3/c1-9-6-7-11(10(2)8-9)14(16)12-4-3-5-13(12)15(17)18/h6-8,12-13H,3-5H2,1-2H3,(H,17,18)/t12-,13+/m0/s1