CAS 733740-19-7
:rel-(1R,2S)-2-(2,5-Dimethylbenzoyl)cyclopentanecarboxylic acid
Description:
Rel-(1R,2S)-2-(2,5-Dimethylbenzoyl)cyclopentanecarboxylic acid is a chiral compound characterized by its unique stereochemistry and functional groups. It features a cyclopentane ring substituted with a carboxylic acid group and a 2,5-dimethylbenzoyl moiety, which contributes to its potential applications in organic synthesis and pharmaceuticals. The presence of the carboxylic acid group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The dimethylbenzoyl group enhances its hydrophobic characteristics, potentially influencing its interactions in biological systems. This compound's stereochemistry, denoted by the (1R,2S) configuration, suggests specific spatial arrangements that can affect its reactivity and biological activity. As a result, it may exhibit unique properties in terms of binding affinity and selectivity in various chemical reactions or biological interactions. Overall, this compound's structural features make it of interest in the fields of medicinal chemistry and materials science.
Formula:C15H18O3
InChI:InChI=1/C15H18O3/c1-9-6-7-10(2)13(8-9)14(16)11-4-3-5-12(11)15(17)18/h6-8,11-12H,3-5H2,1-2H3,(H,17,18)/t11-,12+/s2
InChI key:InChIKey=FLJWIBAXNGPNHL-WEUYFXHZNA-N
SMILES:C(=O)([C@H]1[C@@H](C(O)=O)CCC1)C2=C(C)C=CC(C)=C2
Synonyms:- Cyclopentanecarboxylic acid, 2-(2,5-dimethylbenzoyl)-, (1R,2S)-rel-
- rel-(1R,2S)-2-(2,5-Dimethylbenzoyl)cyclopentanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.