CAS 733740-20-0
:rel-(1R,2S)-2-(2,6-Dimethylbenzoyl)cyclopentanecarboxylic acid
Description:
Rel-(1R,2S)-2-(2,6-Dimethylbenzoyl)cyclopentanecarboxylic acid is a chiral compound characterized by its specific stereochemistry, indicated by the (1R,2S) configuration. This compound features a cyclopentane ring substituted with a carboxylic acid group and a 2,6-dimethylbenzoyl moiety, which contributes to its unique physical and chemical properties. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions, while the aromatic dimethylbenzoyl group may enhance its hydrophobic characteristics. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic nature. Its chiral centers imply potential applications in asymmetric synthesis and pharmaceuticals, where stereochemistry plays a crucial role in biological activity. Additionally, the compound may be of interest in materials science or as a building block in organic synthesis, given its structural complexity and functional groups. Overall, its unique structure and properties make it a subject of interest in various fields of chemistry.
Formula:C15H18O3
InChI:InChI=1/C15H18O3/c1-9-5-3-6-10(2)13(9)14(16)11-7-4-8-12(11)15(17)18/h3,5-6,11-12H,4,7-8H2,1-2H3,(H,17,18)/t11-,12+/s2
InChI key:InChIKey=YJKRDFOFRNIAIY-WEUYFXHZNA-N
SMILES:C(=O)(C1=C(C)C=CC=C1C)[C@H]2[C@@H](C(O)=O)CCC2
Synonyms:- rel-(1R,2S)-2-(2,6-Dimethylbenzoyl)cyclopentanecarboxylic acid
- Cyclopentanecarboxylic acid, 2-(2,6-dimethylbenzoyl)-, (1R,2S)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.