CAS 733740-21-1

(1R,2S)-2-(3,4-dimethylbenzoyl)cyclopentane-1-carboxylic acid

Description:

The chemical substance known as (1R,2S)-2-(3,4-dimethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 733740-21-1, is characterized by its unique structural features and functional groups. This compound contains a cyclopentane ring, which is a five-membered carbon ring, and is substituted with a carboxylic acid group (-COOH) at the first position and a 3,4-dimethylbenzoyl group at the second position. The presence of the carboxylic acid group indicates that it can participate in acid-base reactions and may exhibit acidic properties. The stereochemistry, denoted by the (1R,2S) configuration, suggests specific spatial arrangements of the substituents, which can influence the compound's reactivity and interactions with biological systems. Additionally, the dimethylbenzoyl moiety contributes to the compound's hydrophobic characteristics and may affect its solubility and stability in various solvents. Overall, this compound's structural complexity and functional groups make it of interest in fields such as organic synthesis and medicinal chemistry.

Formula: C₁₅H₁₈O₃

InChI: InChI=1/C15H18O3/c1-9-6-7-11(8-10(9)2)14(16)12-4-3-5-13(12)15(17)18/h6-8,12-13H,3-5H2,1-2H3,(H,17,18)/t12-,13+/m0/s1