CAS 733740-41-5

(1R,3S)-3-[2-(2-fluorophenyl)-2-oxo-ethyl]cyclopentane-1-carboxylic acid

Description:

The chemical substance known as (1R,3S)-3-[2-(2-fluorophenyl)-2-oxo-ethyl]cyclopentane-1-carboxylic acid, with the CAS number 733740-41-5, is a cyclopentane derivative featuring a carboxylic acid functional group. This compound is characterized by its chiral centers, which contribute to its stereochemistry, specifically the (1R,3S) configuration. The presence of a 2-fluorophenyl group and a ketone moiety (2-oxo) indicates potential reactivity and interactions typical of aromatic and carbonyl compounds. The cyclopentane ring provides a unique three-dimensional structure that may influence its biological activity and solubility properties. Such compounds are often studied for their potential pharmaceutical applications, particularly in drug design, due to their ability to interact with biological targets. The specific arrangement of functional groups can affect the compound's polarity, stability, and overall reactivity, making it a subject of interest in medicinal chemistry and related fields.

Formula: C₁₄H₁₅FO₃

InChI: InChI=1/C14H15FO3/c15-12-4-2-1-3-11(12)13(16)8-9-5-6-10(7-9)14(17)18/h1-4,9-10H,5-8H2,(H,17,18)/t9-,10+/m0/s1

cis-3-[2-(2-fluorophenyl)-2-oxoethyl]cyclopentane-1-carboxylic acid

CAS: 733740-41-5

Formula: C₁₄H₁₅FO₃

Purity: 95.0%

Molecular weight: 250.269

Ref: 10-F201103