CymitQuimica logo

CAS 733740-51-7

:

rel-(1R,2S)-2-(2-Oxo-2-phenylethyl)cyclopentanecarboxylic acid

Description:
Rel-(1R,2S)-2-(2-Oxo-2-phenylethyl)cyclopentanecarboxylic acid is a chiral compound characterized by its unique cyclopentane ring structure, which is substituted with a carboxylic acid group and a phenylethyl ketone moiety. The presence of the chiral centers at the 1 and 2 positions of the cyclopentane ring imparts specific stereochemical properties, influencing its reactivity and interactions in biological systems. This compound is likely to exhibit moderate solubility in organic solvents, while its carboxylic acid group may confer some degree of hydrophilicity, allowing for potential interactions with polar solvents. The ketone functionality contributes to its reactivity, making it a candidate for various chemical transformations. Additionally, the compound may exhibit interesting pharmacological properties due to its structural features, which could be explored in medicinal chemistry. Overall, the combination of its stereochemistry and functional groups makes rel-(1R,2S)-2-(2-Oxo-2-phenylethyl)cyclopentanecarboxylic acid a compound of interest in both synthetic and applied chemistry contexts.
Formula:C14H16O3
InChI:InChI=1/C14H16O3/c15-13(10-5-2-1-3-6-10)9-11-7-4-8-12(11)14(16)17/h1-3,5-6,11-12H,4,7-9H2,(H,16,17)/t11-,12+/s2
InChI key:InChIKey=FUYQQVMUACOFNJ-WEUYFXHZNA-N
SMILES:C(C(=O)C1=CC=CC=C1)[C@H]2[C@H](C(O)=O)CCC2
Synonyms:
  • rel-(1R,2S)-2-(2-Oxo-2-phenylethyl)cyclopentanecarboxylic acid
  • Cyclopentanecarboxylic acid, 2-(2-oxo-2-phenylethyl)-, (1R,2S)-rel-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.