CAS 733740-55-1

rel-(1R,2S)-2-[2-(2-Methoxyphenyl)-2-oxoethyl]cyclopentanecarboxylic acid

Description:

Rel-(1R,2S)-2-[2-(2-Methoxyphenyl)-2-oxoethyl]cyclopentanecarboxylic acid is a chemical compound characterized by its unique structural features, which include a cyclopentane ring and a carboxylic acid functional group. The compound exhibits chirality, with specific stereochemistry denoted by the (1R,2S) configuration, indicating the spatial arrangement of its atoms. The presence of the methoxyphenyl group contributes to its potential for various interactions, including hydrophobic and π-π stacking interactions, which may influence its biological activity and solubility. As a carboxylic acid, it can participate in acid-base reactions and may form salts or esters under appropriate conditions. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its specific properties, such as melting point, solubility, and reactivity, would depend on the surrounding environment and the presence of other functional groups. Overall, this compound represents a class of organic molecules with diverse applications in chemical research and drug development.

Formula: C₁₅H₁₈O₄

InChI: InChI=1/C15H18O4/c1-19-14-8-3-2-6-12(14)13(16)9-10-5-4-7-11(10)15(17)18/h2-3,6,8,10-11H,4-5,7,9H2,1H3,(H,17,18)/t10-,11+/s2

InChI key: InChIKey=HKSRAJZPMPZATD-WIBLRKLZNA-N

SMILES: C(C[C@H]1[C@H](C(O)=O)CCC1)(=O)C2=C(OC)C=CC=C2

Synonyms:

• rel-(1R,2S)-2-[2-(2-Methoxyphenyl)-2-oxoethyl]cyclopentanecarboxylic acid
• Cyclopentanecarboxylic acid, 2-[2-(2-methoxyphenyl)-2-oxoethyl]-, (1R,2S)-rel-