CAS 733740-57-3
:rel-(1R,2S)-2-[2-(4-Methoxyphenyl)-2-oxoethyl]cyclopentanecarboxylic acid
Description:
Rel-(1R,2S)-2-[2-(4-Methoxyphenyl)-2-oxoethyl]cyclopentanecarboxylic acid is a chemical compound characterized by its unique structural features, including a cyclopentane ring and a carboxylic acid functional group. The presence of the 4-methoxyphenyl group contributes to its aromatic properties, while the oxoethyl substituent enhances its reactivity and potential biological activity. This compound is typically studied in the context of medicinal chemistry and drug development due to its structural complexity and potential pharmacological effects. Its stereochemistry, indicated by the (1R,2S) configuration, suggests specific spatial arrangements that can influence its interaction with biological targets. The compound's solubility, stability, and reactivity can vary based on environmental conditions, making it a subject of interest in various chemical and pharmaceutical applications. Overall, rel-(1R,2S)-2-[2-(4-Methoxyphenyl)-2-oxoethyl]cyclopentanecarboxylic acid exemplifies the intricate relationship between molecular structure and function in organic chemistry.
Formula:C15H18O4
InChI:InChI=1/C15H18O4/c1-19-12-7-5-10(6-8-12)14(16)9-11-3-2-4-13(11)15(17)18/h5-8,11,13H,2-4,9H2,1H3,(H,17,18)/t11-,13+/s2
InChI key:InChIKey=BFVLIYRMUAIYEL-VEZULTJBNA-N
SMILES:C(O)(=O)[C@H]1[C@H](CC(=O)C2=CC=C(OC)C=C2)CCC1
Synonyms:- Cyclopentanecarboxylic acid, 2-[2-(4-methoxyphenyl)-2-oxoethyl]-, (1R,2S)-rel-
- rel-(1R,2S)-2-[2-(4-Methoxyphenyl)-2-oxoethyl]cyclopentanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.