CAS 733740-64-2
:(1R,2S)-2-[2-(4-chlorophenyl)-2-oxo-ethyl]cyclopentane-1-carboxylic acid
Description:
The chemical substance known as (1R,2S)-2-[2-(4-chlorophenyl)-2-oxo-ethyl]cyclopentane-1-carboxylic acid, with the CAS number 733740-64-2, is characterized by its unique structural features that include a cyclopentane ring and a carboxylic acid functional group. This compound exhibits chirality, indicated by the (1R,2S) configuration, which suggests that it has two stereocenters, leading to potential differences in biological activity or reactivity based on its stereochemistry. The presence of a 4-chlorophenyl group and a keto group (2-oxo) contributes to its overall reactivity and potential interactions in biological systems. As a carboxylic acid, it is likely to exhibit acidic properties, participating in hydrogen bonding and influencing solubility in polar solvents. The compound may have applications in medicinal chemistry or as a building block in organic synthesis, particularly due to its structural complexity and functional groups that can engage in various chemical reactions. Further studies would be necessary to explore its specific properties and potential uses in pharmaceuticals or other fields.
Formula:C14H15ClO3
InChI:InChI=1/C14H15ClO3/c15-11-6-4-9(5-7-11)13(16)8-10-2-1-3-12(10)14(17)18/h4-7,10,12H,1-3,8H2,(H,17,18)/t10-,12+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.