CymitQuimica logo

CAS 733740-65-3

:

(1R,2S)-2-[2-(3-fluorophenyl)-2-oxo-ethyl]cyclopentane-1-carboxylic acid

Description:
The chemical substance known as (1R,2S)-2-[2-(3-fluorophenyl)-2-oxo-ethyl]cyclopentane-1-carboxylic acid, with the CAS number 733740-65-3, is a chiral compound characterized by its cyclopentane backbone and the presence of a carboxylic acid functional group. This compound features a fluorophenyl substituent, which contributes to its unique chemical properties and potential biological activity. The specific stereochemistry indicated by the (1R,2S) configuration suggests that it has distinct spatial arrangements of its atoms, which can significantly influence its reactivity and interactions with biological targets. The presence of the keto group (2-oxo) further adds to its reactivity, potentially allowing for various chemical transformations. Such compounds are often of interest in medicinal chemistry due to their potential therapeutic applications, particularly in the development of pharmaceuticals. The fluorine atom may enhance lipophilicity and metabolic stability, making this compound a candidate for further investigation in drug development.
Formula:C14H15FO3
InChI:InChI=1/C14H15FO3/c15-11-5-1-4-10(7-11)13(16)8-9-3-2-6-12(9)14(17)18/h1,4-5,7,9,12H,2-3,6,8H2,(H,17,18)/t9-,12+/m0/s1
InChI key:InChIKey=QBBQWPROZSALEY-JVMLCUHDNA-N
SMILES:C(C(=O)C1=CC(F)=CC=C1)[C@H]2[C@H](C(O)=O)CCC2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.