CAS 733740-66-4

rel-(1R,2S)-2-[2-(4-Fluorophenyl)-2-oxoethyl]cyclopentanecarboxylic acid

Description:

Rel-(1R,2S)-2-[2-(4-Fluorophenyl)-2-oxoethyl]cyclopentanecarboxylic acid is a chemical compound characterized by its specific stereochemistry and functional groups. It features a cyclopentane ring with a carboxylic acid group, which contributes to its acidity and potential reactivity. The presence of a 4-fluorophenyl group indicates that the compound has aromatic characteristics, which can influence its electronic properties and interactions with biological systems. The oxoethyl substituent suggests the presence of a carbonyl group, enhancing the compound's reactivity and potential for forming various derivatives. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Its stereochemistry, denoted by the (1R,2S) configuration, is crucial for determining its biological activity and interaction with target molecules. Overall, this compound's unique structure and functional groups make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₄H₁₅FO₃

InChI: InChI=1/C14H15FO3/c15-11-6-4-9(5-7-11)13(16)8-10-2-1-3-12(10)14(17)18/h4-7,10,12H,1-3,8H2,(H,17,18)/t10-,12+/s2

InChI key: InChIKey=DBUOURRJXWWVAC-XWJGPBAUNA-N

SMILES: C(O)(=O)[C@H]1[C@H](CC(=O)C2=CC=C(F)C=C2)CCC1

Synonyms:

• rel-(1R,2S)-2-[2-(4-Fluorophenyl)-2-oxoethyl]cyclopentanecarboxylic acid
• Cyclopentanecarboxylic acid, 2-[2-(4-fluorophenyl)-2-oxoethyl]-, (1R,2S)-rel-