CymitQuimica logo

CAS 733740-67-5

:

rel-(1R,2S)-2-[2-(2-Bromophenyl)-2-oxoethyl]cyclopentanecarboxylic acid

Description:
Rel-(1R,2S)-2-[2-(2-Bromophenyl)-2-oxoethyl]cyclopentanecarboxylic acid is a chemical compound characterized by its unique structural features, which include a cyclopentane ring and a carboxylic acid functional group. The presence of a bromophenyl moiety contributes to its potential biological activity and lipophilicity. The specific stereochemistry indicated by the (1R,2S) configuration suggests that the compound has distinct spatial arrangements that can influence its reactivity and interactions with biological targets. This compound may exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can affect its solubility and reactivity in various solvents. Additionally, the presence of the bromine atom can enhance the compound's electrophilic character, making it a candidate for further chemical modifications or applications in medicinal chemistry. Overall, the combination of these structural elements may lead to interesting pharmacological properties, warranting further investigation in drug development or synthetic chemistry.
Formula:C14H15BrO3
InChI:InChI=1/C14H15BrO3/c15-12-7-2-1-5-11(12)13(16)8-9-4-3-6-10(9)14(17)18/h1-2,5,7,9-10H,3-4,6,8H2,(H,17,18)/t9-,10+/s2
InChI key:InChIKey=UVVMQPBDJHJONA-NLJMKPLXNA-N
SMILES:C(C(=O)C1=C(Br)C=CC=C1)[C@H]2[C@H](C(O)=O)CCC2
Synonyms:
  • Cyclopentanecarboxylic acid, 2-[2-(2-bromophenyl)-2-oxoethyl]-, (1R,2S)-rel-
  • rel-(1R,2S)-2-[2-(2-Bromophenyl)-2-oxoethyl]cyclopentanecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.