CymitQuimica logo

CAS 733740-69-7

:

(1R,2S)-2-[2-(2-fluorophenyl)-2-oxo-ethyl]cyclopentane-1-carboxylic acid

Description:
The chemical substance known as (1R,2S)-2-[2-(2-fluorophenyl)-2-oxo-ethyl]cyclopentane-1-carboxylic acid, with the CAS number 733740-69-7, is a chiral compound characterized by its cyclopentane ring structure and the presence of a carboxylic acid functional group. This compound features a fluorophenyl substituent, which contributes to its unique chemical properties and potential biological activity. The stereochemistry indicated by the (1R,2S) notation suggests specific spatial arrangements of atoms, which can influence the compound's reactivity and interactions with biological targets. The presence of the keto group (2-oxo) further adds to its chemical reactivity, potentially allowing for various synthetic transformations. Such compounds may be of interest in medicinal chemistry for their potential therapeutic applications, particularly in the development of pharmaceuticals. The fluorine atom can enhance lipophilicity and metabolic stability, making this compound a candidate for further investigation in drug design and development.
Formula:C14H15FO3
InChI:InChI=1/C14H15FO3/c15-12-7-2-1-5-11(12)13(16)8-9-4-3-6-10(9)14(17)18/h1-2,5,7,9-10H,3-4,6,8H2,(H,17,18)/t9-,10+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.