CAS 733740-70-0

rel-(1R,2S)-2-[2-(2-Iodophenyl)-2-oxoethyl]cyclopentanecarboxylic acid

Description:

Rel-(1R,2S)-2-[2-(2-Iodophenyl)-2-oxoethyl]cyclopentanecarboxylic acid is a chemical compound characterized by its unique structural features, including a cyclopentane ring and a carboxylic acid functional group. The presence of the 2-iodophenyl moiety contributes to its potential biological activity and reactivity. This compound is likely to exhibit specific stereochemical properties due to its chiral centers, which can influence its interaction with biological targets. The iodine atom in the structure may enhance lipophilicity and alter the compound's pharmacokinetic properties. As a carboxylic acid, it can participate in acid-base reactions and form salts or esters. The compound's molecular weight, solubility, and stability can vary based on environmental conditions and the presence of other functional groups. Its applications may extend to medicinal chemistry, where it could serve as a lead compound for drug development or as a tool in biochemical research. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₄H₁₅IO₃

InChI: InChI=1/C14H15IO3/c15-12-7-2-1-5-11(12)13(16)8-9-4-3-6-10(9)14(17)18/h1-2,5,7,9-10H,3-4,6,8H2,(H,17,18)/t9-,10+/s2

InChI key: InChIKey=AVVNAOHVFDKTII-NLJMKPLXNA-N

SMILES: C(C(=O)C1=C(I)C=CC=C1)[C@H]2[C@H](C(O)=O)CCC2

Synonyms:

• rel-(1R,2S)-2-[2-(2-Iodophenyl)-2-oxoethyl]cyclopentanecarboxylic acid
• Cyclopentanecarboxylic acid, 2-[2-(2-iodophenyl)-2-oxoethyl]-, (1R,2S)-rel-