CymitQuimica logo

CAS 733740-71-1

:

rel-(1R,2S)-2-[2-(3-Iodophenyl)-2-oxoethyl]cyclopentanecarboxylic acid

Description:
Rel-(1R,2S)-2-[2-(3-Iodophenyl)-2-oxoethyl]cyclopentanecarboxylic acid is a chemical compound characterized by its unique structural features, including a cyclopentane ring and a carboxylic acid functional group. The presence of the 3-iodophenyl moiety contributes to its potential biological activity, as halogenated phenyl groups often enhance the lipophilicity and reactivity of organic compounds. The stereochemistry indicated by the (1R,2S) configuration suggests specific spatial arrangements of atoms, which can significantly influence the compound's interactions with biological targets. This compound may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and potential reactivity due to the electrophilic nature of the carbonyl groups. Its applications could range from medicinal chemistry to materials science, depending on its biological activity and reactivity profile. Further studies would be necessary to fully elucidate its properties, including its pharmacokinetics, mechanism of action, and potential therapeutic uses.
Formula:C14H15IO3
InChI:InChI=1/C14H15IO3/c15-11-5-1-4-10(7-11)13(16)8-9-3-2-6-12(9)14(17)18/h1,4-5,7,9,12H,2-3,6,8H2,(H,17,18)/t9-,12+/m0/s1
InChI key:InChIKey=UQCHWAXAZHUWKE-JVMLCUHDNA-N
SMILES:C(C(=O)C1=CC(I)=CC=C1)[C@H]2[C@H](C(O)=O)CCC2
Synonyms:
  • rel-(1R,2S)-2-[2-(3-Iodophenyl)-2-oxoethyl]cyclopentanecarboxylic acid
  • Cyclopentanecarboxylic acid, 2-[2-(3-iodophenyl)-2-oxoethyl]-, (1R,2S)-rel-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.