CAS 733740-74-4

rel-(1R,2S)-2-[2-Oxo-2-[3-(trifluoromethyl)phenyl]ethyl]cyclopentanecarboxylic acid

Description:

Rel-(1R,2S)-2-[2-Oxo-2-[3-(trifluoromethyl)phenyl]ethyl]cyclopentanecarboxylic acid is a chemical compound characterized by its unique structural features, which include a cyclopentane ring and a trifluoromethyl-substituted phenyl group. The compound exhibits chirality, indicated by its specific stereochemical configuration (1R,2S), which can influence its biological activity and interactions. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit polar characteristics, enhancing its solubility in polar solvents. The trifluoromethyl group is known for its electron-withdrawing properties, which can significantly affect the compound's reactivity and stability. Additionally, the keto group (2-oxo) contributes to the compound's potential as a reactive intermediate in various chemical reactions. Overall, this compound's unique combination of functional groups and stereochemistry may render it of interest in pharmaceutical research and development, particularly in the design of biologically active molecules.

Formula: C₁₅H₁₅F₃O₃

InChI: InChI=1/C15H15F3O3/c16-15(17,18)11-5-1-4-10(7-11)13(19)8-9-3-2-6-12(9)14(20)21/h1,4-5,7,9,12H,2-3,6,8H2,(H,20,21)/t9-,12+/s2

InChI key: InChIKey=BCCWSJZUORSYGK-JVMLCUHDNA-N

SMILES: C(C(=O)C1=CC(C(F)(F)F)=CC=C1)[C@H]2[C@H](C(O)=O)CCC2

Synonyms:

• rel-(1R,2S)-2-[2-Oxo-2-[3-(trifluoromethyl)phenyl]ethyl]cyclopentanecarboxylic acid
• Cyclopentanecarboxylic acid, 2-[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl]-, (1R,2S)-rel-