CAS 733740-76-6
:rel-(1R,2S)-2-[2-(2-Nitrophenyl)-2-oxoethyl]cyclopentanecarboxylic acid
Description:
Rel-(1R,2S)-2-[2-(2-Nitrophenyl)-2-oxoethyl]cyclopentanecarboxylic acid is a chemical compound characterized by its unique structural features, which include a cyclopentane ring and a carboxylic acid functional group. The presence of a nitrophenyl moiety contributes to its potential reactivity and biological activity. This compound is likely to exhibit specific stereochemistry, as indicated by its (1R,2S) configuration, which can influence its interactions with biological targets. The nitro group may enhance its electrophilic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the carboxylic acid group can participate in hydrogen bonding and may affect the solubility and stability of the compound in different solvents. Overall, the combination of these functional groups suggests that this compound could have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological activities would require further investigation.
Formula:C14H15NO5
InChI:InChI=1/C14H15NO5/c16-13(8-9-4-3-6-10(9)14(17)18)11-5-1-2-7-12(11)15(19)20/h1-2,5,7,9-10H,3-4,6,8H2,(H,17,18)/t9-,10+/s2
InChI key:InChIKey=CTCGTAGEILSZFF-NLJMKPLXNA-N
SMILES:C(C[C@H]1[C@H](C(O)=O)CCC1)(=O)C2=C(N(=O)=O)C=CC=C2
Synonyms:- rel-(1R,2S)-2-[2-(2-Nitrophenyl)-2-oxoethyl]cyclopentanecarboxylic acid
- Cyclopentanecarboxylic acid, 2-[2-(2-nitrophenyl)-2-oxoethyl]-, (1R,2S)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.