CAS 733740-80-2
:(1R,2R)-2-(3-methylbenzoyl)cyclopentane-1-carboxylic acid
Description:
(1R,2R)-2-(3-methylbenzoyl)cyclopentane-1-carboxylic acid is a chiral compound characterized by its cyclopentane ring structure, which is substituted with a carboxylic acid group and a 3-methylbenzoyl moiety. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The specific stereochemistry, indicated by the (1R,2R) configuration, suggests that the compound exhibits optical activity, making it relevant in the field of asymmetric synthesis and pharmaceuticals. Its molecular structure contributes to its potential interactions in biological systems, which may influence its pharmacological properties. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this compound's unique structural features and stereochemistry make it a subject of interest in organic chemistry and medicinal chemistry research.
Formula:C14H16O3
InChI:InChI=1/C14H16O3/c1-9-4-2-5-10(8-9)13(15)11-6-3-7-12(11)14(16)17/h2,4-5,8,11-12H,3,6-7H2,1H3,(H,16,17)/t11-,12-/m1/s1
SMILES:Cc1cccc(c1)C(=O)[C@@H]1CCC[C@H]1C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.