CAS 733740-82-4

(1R,2R)-2-(2-methoxybenzoyl)cyclopentane-1-carboxylic acid

Description:

The chemical substance known as (1R,2R)-2-(2-methoxybenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 733740-82-4, is a chiral compound characterized by its cyclopentane core structure, which is substituted at the 1 and 2 positions. The presence of a carboxylic acid functional group contributes to its acidity and potential reactivity, while the 2-methoxybenzoyl moiety enhances its aromatic character and may influence its solubility and interaction with biological systems. This compound is likely to exhibit specific stereochemical properties due to its chiral centers, which can affect its pharmacological activity and binding interactions in biological contexts. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature, making it important to consider these factors in practical applications. Overall, this compound represents a unique combination of structural features that may be of interest in various chemical and biological research fields.

Formula: C₁₄H₁₆O₄

InChI: InChI=1/C14H16O4/c1-18-12-8-3-2-5-11(12)13(15)9-6-4-7-10(9)14(16)17/h2-3,5,8-10H,4,6-7H2,1H3,(H,16,17)/t9-,10-/m1/s1

SMILES: COc1ccccc1C(=O)[C@@H]1CCC[C@H]1C(=O)O