CymitQuimica logo

CAS 733740-83-5

:

(1R,2R)-2-(3-methoxybenzoyl)cyclopentane-1-carboxylic acid

Description:
(1R,2R)-2-(3-methoxybenzoyl)cyclopentane-1-carboxylic acid is a chiral compound characterized by its cyclopentane ring structure, which is substituted at the 1 and 2 positions. The presence of a carboxylic acid functional group contributes to its acidity and potential reactivity, while the 3-methoxybenzoyl moiety introduces aromatic characteristics and enhances its lipophilicity. This compound's stereochemistry, indicated by the (1R,2R) configuration, suggests specific spatial arrangements that can influence its biological activity and interactions with other molecules. The methoxy group on the benzoyl ring can also affect the compound's solubility and stability. Overall, this substance may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry and drug development. Its CAS number, 733740-83-5, allows for easy identification and retrieval of information regarding its properties and applications in scientific literature.
Formula:C14H16O4
InChI:InChI=1/C14H16O4/c1-18-10-5-2-4-9(8-10)13(15)11-6-3-7-12(11)14(16)17/h2,4-5,8,11-12H,3,6-7H2,1H3,(H,16,17)/t11-,12-/m1/s1
SMILES:COc1cccc(c1)C(=O)[C@@H]1CCC[C@H]1C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.