CAS 733740-84-6

rel-(1R,2R)-2-(4-Methoxybenzoyl)cyclopentanecarboxylic acid

Description:

Rel-(1R,2R)-2-(4-Methoxybenzoyl)cyclopentanecarboxylic acid is a chiral compound characterized by its cyclopentane ring structure, which is substituted with a methoxybenzoyl group and a carboxylic acid functional group. The presence of the methoxy group enhances its lipophilicity and can influence its biological activity. The specific stereochemistry, indicated by the (1R,2R) configuration, suggests that the compound may exhibit unique interactions in biological systems, potentially affecting its pharmacological properties. This compound is likely to be solid at room temperature and may exhibit moderate solubility in organic solvents while being less soluble in water due to its hydrophobic characteristics. Its carboxylic acid group can participate in hydrogen bonding, which may influence its reactivity and interactions with other molecules. The compound's potential applications could span various fields, including pharmaceuticals and materials science, where its specific stereochemistry and functional groups may be leveraged for targeted effects.

Formula: C₁₄H₁₆O₄

InChI: InChI=1/C14H16O4/c1-18-10-7-5-9(6-8-10)13(15)11-3-2-4-12(11)14(16)17/h5-8,11-12H,2-4H2,1H3,(H,16,17)/t11-,12-/m1/s1

InChI key: InChIKey=SRFOISVYVQZJQU-XXCBQWOANA-N

SMILES: C(=O)([C@H]1[C@H](C(O)=O)CCC1)C2=CC=C(OC)C=C2

Synonyms:

• rel-(1R,2R)-2-(4-Methoxybenzoyl)cyclopentanecarboxylic acid
• Cyclopentanecarboxylic acid, 2-(4-methoxybenzoyl)-, (1R,2R)-rel-
• (1R,2R)-2-(4-methoxybenzoyl)cyclopentane-1-carboxylic acid
• TRANS-2-(4-METHOXYBENZOYL)CYCLOPENTANE-1-CARBOXYLIC ACID