CAS 733740-87-9
:(1R,2R)-2-(4-cyanobenzoyl)cyclopentane-1-carboxylic acid
Description:
(1R,2R)-2-(4-cyanobenzoyl)cyclopentane-1-carboxylic acid is a chemical compound characterized by its cyclopentane structure, which features a carboxylic acid functional group and a cyanobenzoyl substituent. The compound exhibits chirality, with specific stereochemistry indicated by the (1R,2R) configuration, which affects its physical and chemical properties. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or organic synthesis due to its unique structural features. The presence of the carboxylic acid group suggests it can participate in acid-base reactions, while the cyanobenzoyl moiety may contribute to its reactivity and interaction with biological targets. Additionally, the compound may exhibit specific solubility characteristics depending on the solvent used, influenced by its functional groups. Overall, this compound's unique structure and functional groups make it of interest in various chemical research and development contexts.
Formula:C14H13NO3
InChI:InChI=1/C14H13NO3/c15-8-9-4-6-10(7-5-9)13(16)11-2-1-3-12(11)14(17)18/h4-7,11-12H,1-3H2,(H,17,18)/t11-,12-/m1/s1
SMILES:C1C[C@H]([C@@H](C1)C(=O)O)C(=O)c1ccc(cc1)C#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.