CAS 733740-96-0

rel-(1R,2R)-2-(3-Bromobenzoyl)cyclopentanecarboxylic acid

Description:

Rel-(1R,2R)-2-(3-Bromobenzoyl)cyclopentanecarboxylic acid is a chiral compound characterized by its cyclopentane ring structure, which is substituted with a bromobenzoyl group and a carboxylic acid functional group. The presence of the bromine atom in the 3-position of the benzoyl moiety introduces significant steric and electronic effects, influencing the compound's reactivity and interactions. The specific stereochemistry, indicated by the (1R,2R) configuration, suggests that the compound exhibits optical activity, making it relevant in asymmetric synthesis and pharmaceutical applications. This compound may participate in various chemical reactions, including esterification and amidation, due to its carboxylic acid functionality. Its unique structure and properties make it a subject of interest in medicinal chemistry and materials science, particularly in the development of novel therapeutic agents or as intermediates in organic synthesis. As with many brominated compounds, it may also exhibit specific biological activities, warranting further investigation into its potential applications.

Formula: C₁₃H₁₃BrO₃

InChI: InChI=1/C13H13BrO3/c14-9-4-1-3-8(7-9)12(15)10-5-2-6-11(10)13(16)17/h1,3-4,7,10-11H,2,5-6H2,(H,16,17)/t10-,11-/s2

InChI key: InChIKey=WASZXBDJJWRQGI-DUJBIPCPNA-N

SMILES: C(=O)([C@H]1[C@H](C(O)=O)CCC1)C2=CC(Br)=CC=C2

Synonyms:

• rel-(1R,2R)-2-(3-Bromobenzoyl)cyclopentanecarboxylic acid
• Cyclopentanecarboxylic acid, 2-(3-bromobenzoyl)-, (1R,2R)-rel-