CymitQuimica logo

CAS 733740-98-2

:

(1R,2R)-2-[(4-bromophenyl)carbonyl]cyclopentanecarboxylic acid

Description:
(1R,2R)-2-[(4-bromophenyl)carbonyl]cyclopentanecarboxylic acid is a chiral compound characterized by its cyclopentane ring structure, which is substituted with a carboxylic acid group and a 4-bromophenyl carbonyl moiety. The presence of the bromine atom on the phenyl ring enhances the compound's lipophilicity and may influence its biological activity. The specific stereochemistry indicated by (1R,2R) suggests that the compound has two chiral centers, which can significantly affect its reactivity and interaction with biological targets. This compound may exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility and reactivity in various chemical environments. Additionally, the presence of the carbonyl group can participate in various reactions, including nucleophilic additions and acylation processes. Overall, the unique structural features of this compound make it of interest in medicinal chemistry and materials science, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C13H13BrO3
InChI:InChI=1/C13H13BrO3/c14-9-6-4-8(5-7-9)12(15)10-2-1-3-11(10)13(16)17/h4-7,10-11H,1-3H2,(H,16,17)/t10-,11-/m1/s1
SMILES:C1C[C@H]([C@@H](C1)C(=O)O)C(=O)c1ccc(cc1)Br
Synonyms:
  • (1R,2R)-2-(4-bromobenzoyl)cyclopentanecarboxylic acid
  • acide (1R,2R)-2-(4-bromobenzoyl)cyclopentanecarboxylique
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.