CAS 733741-00-9

(1R,2R)-2-(3-chlorobenzoyl)cyclopentane-1-carboxylic acid

Description:

(1R,2R)-2-(3-chlorobenzoyl)cyclopentane-1-carboxylic acid is a chiral compound characterized by its cyclopentane ring structure, which is substituted at the 1 and 2 positions. The presence of a carboxylic acid functional group at the 1-position contributes to its acidity and potential reactivity in various chemical reactions. The 3-chlorobenzoyl group at the 2-position introduces a chlorinated aromatic moiety, which can influence the compound's electronic properties and hydrophobicity. This compound is likely to exhibit specific stereochemical properties due to its chiral centers, which can affect its biological activity and interactions with other molecules. The chlorobenzoyl substituent may also enhance the compound's lipophilicity, making it more soluble in organic solvents. Overall, the unique combination of functional groups and stereochemistry in (1R,2R)-2-(3-chlorobenzoyl)cyclopentane-1-carboxylic acid suggests potential applications in pharmaceuticals or agrochemicals, where such structural features can be critical for efficacy and selectivity.

Formula: C₁₃H₁₃ClO₃

InChI: InChI=1/C13H13ClO3/c14-9-4-1-3-8(7-9)12(15)10-5-2-6-11(10)13(16)17/h1,3-4,7,10-11H,2,5-6H2,(H,16,17)/t10-,11-/m1/s1

SMILES: c1cc(cc(c1)Cl)C(=O)[C@@H]1CCC[C@H]1C(=O)O