CAS 733741-02-1

(1R,2R)-2-(4-chlorobenzoyl)cyclopentane-1-carboxylic acid

Description:

(1R,2R)-2-(4-chlorobenzoyl)cyclopentane-1-carboxylic acid is a chiral compound characterized by its cyclopentane ring structure, which is substituted at the 1 and 2 positions. The presence of a carboxylic acid functional group at the 1-position contributes to its acidity and reactivity, while the 4-chlorobenzoyl group at the 2-position introduces significant steric and electronic effects due to the chlorine atom's electronegativity and the aromatic nature of the benzoyl moiety. This compound is likely to exhibit specific stereochemical properties due to its defined (1R,2R) configuration, which can influence its interactions in biological systems and its potential as a pharmaceutical agent. The chlorobenzoyl group may enhance lipophilicity, affecting solubility and permeability. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of selective inhibitors or modulators in various biochemical pathways.

Formula: C₁₃H₁₃ClO₃

InChI: InChI=1/C13H13ClO3/c14-9-6-4-8(5-7-9)12(15)10-2-1-3-11(10)13(16)17/h4-7,10-11H,1-3H2,(H,16,17)/t10-,11-/m1/s1

SMILES: C1C[C@H]([C@@H](C1)C(=O)O)C(=O)c1ccc(cc1)Cl