CymitQuimica logo

CAS 733741-04-3

:

rel-(1R,2R)-2-(3-Fluorobenzoyl)cyclopentanecarboxylic acid

Description:
Rel-(1R,2R)-2-(3-Fluorobenzoyl)cyclopentanecarboxylic acid is a chiral compound characterized by its cyclopentane ring structure, which is substituted with a carboxylic acid group and a 3-fluorobenzoyl moiety. The presence of the fluorine atom in the aromatic ring can influence the compound's reactivity and biological activity, often enhancing lipophilicity and altering interaction with biological targets. The specific stereochemistry indicated by the (1R,2R) configuration suggests that the compound has distinct spatial arrangements that can affect its pharmacological properties. This compound may exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence solubility and reactivity. Its unique structure may also allow for specific interactions in biological systems, making it of interest in medicinal chemistry and drug design. Overall, the characteristics of this compound make it a valuable subject for further research in various chemical and pharmaceutical applications.
Formula:C13H13FO3
InChI:InChI=1/C13H13FO3/c14-9-4-1-3-8(7-9)12(15)10-5-2-6-11(10)13(16)17/h1,3-4,7,10-11H,2,5-6H2,(H,16,17)/t10-,11-/s2
InChI key:InChIKey=YWYRHYHQPXIURO-DUJBIPCPNA-N
SMILES:C(=O)([C@H]1[C@H](C(O)=O)CCC1)C2=CC(F)=CC=C2
Synonyms:
  • rel-(1R,2R)-2-(3-Fluorobenzoyl)cyclopentanecarboxylic acid
  • Cyclopentanecarboxylic acid, 2-(3-fluorobenzoyl)-, (1R,2R)-rel-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.