CymitQuimica logo

CAS 733741-10-1

:

(1R,2R)-2-(4-pentylbenzoyl)cyclopentane-1-carboxylic acid

Description:
The chemical substance known as (1R,2R)-2-(4-pentylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 733741-10-1, is a chiral compound characterized by its cyclopentane core structure, which is substituted with a carboxylic acid group and a 4-pentylbenzoyl moiety. This compound exhibits specific stereochemistry, indicated by the (1R,2R) configuration, which can influence its physical and chemical properties, such as solubility, melting point, and reactivity. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions, while the aromatic and aliphatic components may contribute to its hydrophobic characteristics. Such compounds are often studied for their potential applications in pharmaceuticals, materials science, and organic synthesis due to their unique structural features. Additionally, the presence of the pentyl chain may enhance the compound's lipophilicity, affecting its biological activity and interaction with biological membranes. Overall, this compound represents a complex structure with potential utility in various chemical and biological contexts.
Formula:C18H24O3
InChI:InChI=1/C18H24O3/c1-2-3-4-6-13-9-11-14(12-10-13)17(19)15-7-5-8-16(15)18(20)21/h9-12,15-16H,2-8H2,1H3,(H,20,21)/t15-,16-/m1/s1
SMILES:CCCCCc1ccc(cc1)C(=O)[C@@H]1CCC[C@H]1C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.