CAS 733741-14-5
:(1R,2R)-2-(2,4-dimethylbenzoyl)cyclopentane-1-carboxylic acid
Description:
The chemical substance known as (1R,2R)-2-(2,4-dimethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 733741-14-5, is a chiral compound featuring a cyclopentane ring substituted with a carboxylic acid and a benzoyl group. Its structure indicates that it possesses both hydrophobic and hydrophilic characteristics, which can influence its solubility in various solvents. The presence of the dimethylbenzoyl moiety suggests potential applications in organic synthesis and pharmaceuticals, particularly in the development of chiral intermediates or active pharmaceutical ingredients. The specific stereochemistry (1R,2R) indicates that the compound has two chiral centers, which can lead to distinct biological activities and interactions. Additionally, the compound may exhibit unique physical properties such as melting point, boiling point, and reactivity, which are essential for its application in chemical processes. Overall, this compound's structural features and stereochemistry make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C15H18O3
InChI:InChI=1/C15H18O3/c1-9-6-7-11(10(2)8-9)14(16)12-4-3-5-13(12)15(17)18/h6-8,12-13H,3-5H2,1-2H3,(H,17,18)/t12-,13-/m1/s1
SMILES:Cc1ccc(c(C)c1)C(=O)[C@@H]1CCC[C@H]1C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.