CAS 733741-15-6
:(1R,2R)-2-(2,5-dimethylbenzoyl)cyclopentane-1-carboxylic acid
Description:
The chemical substance known as (1R,2R)-2-(2,5-dimethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 733741-15-6, is a chiral compound characterized by its cyclopentane core and a carboxylic acid functional group. This compound features a dimethylbenzoyl substituent, which contributes to its unique structural and electronic properties. The presence of the carboxylic acid group indicates that it can participate in hydrogen bonding and may exhibit acidic behavior in solution. The specific stereochemistry, denoted by the (1R,2R) configuration, suggests that the compound has distinct spatial arrangements that can influence its reactivity and interactions with biological systems. Such characteristics make it of interest in various fields, including organic synthesis and medicinal chemistry, where chirality can play a crucial role in the efficacy and safety of pharmaceutical agents. Additionally, the compound's molecular structure may affect its solubility, stability, and potential applications in drug development or as a chemical intermediate.
Formula:C15H18O3
InChI:InChI=1/C15H18O3/c1-9-6-7-10(2)13(8-9)14(16)11-4-3-5-12(11)15(17)18/h6-8,11-12H,3-5H2,1-2H3,(H,17,18)/t11-,12-/m1/s1
SMILES:Cc1ccc(C)c(c1)C(=O)[C@@H]1CCC[C@H]1C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.