CymitQuimica logo

CAS 733741-17-8

:

(1R,2R)-2-(2,6-dimethylbenzoyl)cyclopentane-1-carboxylic acid

Description:
The chemical substance known as (1R,2R)-2-(2,6-dimethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 733741-17-8, is a chiral compound characterized by its cyclopentane core and a carboxylic acid functional group. This compound features a dimethylbenzoyl substituent, which contributes to its unique structural and stereochemical properties. The presence of the carboxylic acid group indicates that it can participate in acid-base reactions, potentially forming salts or esters. Its chirality, denoted by the (1R,2R) configuration, suggests that it may exhibit specific biological activity or interactions, making it of interest in pharmaceutical applications. The compound's molecular structure may influence its solubility, melting point, and reactivity, which are essential characteristics for its potential use in various chemical processes or as an intermediate in organic synthesis. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with stereochemical significance.
Formula:C15H18O3
InChI:InChI=1/C15H18O3/c1-9-5-3-6-10(2)13(9)14(16)11-7-4-8-12(11)15(17)18/h3,5-6,11-12H,4,7-8H2,1-2H3,(H,17,18)/t11-,12-/m1/s1
SMILES:Cc1cccc(C)c1C(=O)[C@@H]1CCC[C@H]1C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.