CymitQuimica logo

CAS 733741-19-0

:

(1R,2R)-2-(3,4-dimethylbenzoyl)cyclopentane-1-carboxylic acid

Description:
The chemical substance known as (1R,2R)-2-(3,4-dimethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 733741-19-0, is a chiral compound characterized by its cyclopentane core structure, which is substituted with a carboxylic acid group and a benzoyl moiety. The presence of the 3,4-dimethylbenzoyl group indicates that the compound has significant steric hindrance and potential for specific interactions due to its bulky substituents. The (1R,2R) configuration suggests that it has specific stereochemical properties, which can influence its reactivity and interactions in biological systems. This compound may exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds. Its unique structure may also confer specific pharmacological or biochemical activities, making it of interest in medicinal chemistry or material science. Overall, the characteristics of this compound are defined by its stereochemistry, functional groups, and the presence of aromatic substituents, which can affect its solubility, reactivity, and potential applications.
Formula:C15H18O3
InChI:InChI=1/C15H18O3/c1-9-6-7-11(8-10(9)2)14(16)12-4-3-5-13(12)15(17)18/h6-8,12-13H,3-5H2,1-2H3,(H,17,18)/t12-,13-/m1/s1
SMILES:Cc1ccc(cc1C)C(=O)[C@@H]1CCC[C@H]1C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.