CymitQuimica logo

CAS 733741-21-4

:

(1R,2R)-2-(3,5-dimethylbenzoyl)cyclopentane-1-carboxylic acid

Description:
The chemical substance known as (1R,2R)-2-(3,5-dimethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 733741-21-4, is a chiral compound characterized by its cyclopentane core and a carboxylic acid functional group. This compound features a 3,5-dimethylbenzoyl substituent, which contributes to its unique structural and chemical properties. The presence of the carboxylic acid group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The specific stereochemistry (1R,2R) suggests that the compound has distinct spatial arrangements that can influence its reactivity and interactions with biological systems. Such compounds are often of interest in pharmaceutical chemistry due to their potential biological activity and the importance of chirality in drug design. Additionally, the presence of the aromatic ring may enhance its stability and influence its electronic properties, making it a candidate for various applications in organic synthesis and medicinal chemistry.
Formula:C15H18O3
InChI:InChI=1/C15H18O3/c1-9-6-10(2)8-11(7-9)14(16)12-4-3-5-13(12)15(17)18/h6-8,12-13H,3-5H2,1-2H3,(H,17,18)/t12-,13-/m1/s1
SMILES:Cc1cc(C)cc(c1)C(=O)[C@@H]1CCC[C@H]1C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.