CAS 733742-60-4

(1R,2S)-2-(3-methylbenzoyl)cyclohexane-1-carboxylic acid

Description:

The chemical substance known as (1R,2S)-2-(3-methylbenzoyl)cyclohexane-1-carboxylic acid, with the CAS number 733742-60-4, is a chiral compound characterized by its cyclohexane ring structure, which is substituted with a carboxylic acid group and a 3-methylbenzoyl moiety. This compound exhibits specific stereochemistry, indicated by the (1R,2S) configuration, which plays a crucial role in its biological activity and interactions. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The aromatic 3-methylbenzoyl group contributes to its hydrophobic character and potential interactions with biological targets. This compound may be of interest in pharmaceutical applications due to its structural features, which could influence its binding affinity and selectivity for certain receptors or enzymes. Overall, its unique structural and stereochemical properties make it a subject of interest in organic synthesis and medicinal chemistry.

Formula: C₁₅H₁₈O₃

InChI: InChI=1/C15H18O3/c1-10-5-4-6-11(9-10)14(16)12-7-2-3-8-13(12)15(17)18/h4-6,9,12-13H,2-3,7-8H2,1H3,(H,17,18)/t12-,13+/m0/s1