CymitQuimica logo

CAS 733742-61-5

:

(1R,2S)-2-(2-methoxybenzoyl)cyclohexane-1-carboxylic acid

Description:
The chemical substance known as (1R,2S)-2-(2-methoxybenzoyl)cyclohexane-1-carboxylic acid, with the CAS number 733742-61-5, is a chiral compound characterized by its cyclohexane backbone and the presence of both a carboxylic acid and a methoxybenzoyl group. This compound exhibits specific stereochemistry, indicated by the (1R,2S) configuration, which influences its reactivity and interactions in biological systems. The methoxybenzoyl moiety contributes to its hydrophobic characteristics, while the carboxylic acid group provides acidic properties, allowing for potential solubility in polar solvents. Such compounds are often studied for their pharmacological properties, as they may exhibit activity in various biological pathways. The presence of the methoxy group can also enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. Overall, this compound's unique structural features make it of interest in medicinal chemistry and drug development, particularly in the design of selective agents with specific therapeutic targets.
Formula:C15H18O4
InChI:InChI=1/C15H18O4/c1-19-13-9-5-4-8-12(13)14(16)10-6-2-3-7-11(10)15(17)18/h4-5,8-11H,2-3,6-7H2,1H3,(H,17,18)/t10-,11+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.