CymitQuimica logo

CAS 733742-64-8

:

(1R,2S)-2-(2-ethylbenzoyl)cyclohexane-1-carboxylic acid

Description:
The chemical substance known as (1R,2S)-2-(2-ethylbenzoyl)cyclohexane-1-carboxylic acid, with the CAS number 733742-64-8, is a chiral compound characterized by its cyclohexane ring structure, which features a carboxylic acid functional group and an ethylbenzoyl substituent. This compound exhibits specific stereochemistry, indicated by the (1R,2S) configuration, which influences its physical and chemical properties, including solubility, reactivity, and biological activity. Typically, compounds of this nature may display moderate to high lipophilicity due to the presence of aromatic and aliphatic groups, which can affect their interaction with biological systems. The carboxylic acid group contributes to acidity and potential hydrogen bonding capabilities, making it relevant in various chemical reactions and applications. Such compounds may be of interest in pharmaceutical research, particularly in the development of drugs or as intermediates in organic synthesis. Understanding the stereochemistry and functional groups is crucial for predicting the behavior and potential applications of this substance in various fields.
Formula:C16H20O3
InChI:InChI=1/C16H20O3/c1-2-11-7-3-4-8-12(11)15(17)13-9-5-6-10-14(13)16(18)19/h3-4,7-8,13-14H,2,5-6,9-10H2,1H3,(H,18,19)/t13-,14+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.