CAS 733742-68-2
:(1R,2S)-2-(2,6-dimethylbenzoyl)cyclohexane-1-carboxylic acid
Description:
The chemical substance known as (1R,2S)-2-(2,6-dimethylbenzoyl)cyclohexane-1-carboxylic acid, with the CAS number 733742-68-2, is a chiral compound characterized by its cyclohexane ring structure and the presence of a carboxylic acid functional group. This compound features a dimethylbenzoyl substituent, which contributes to its unique physical and chemical properties. The stereochemistry indicated by the (1R,2S) configuration suggests specific spatial arrangements of its atoms, influencing its reactivity and interactions with biological systems. Typically, compounds of this nature may exhibit moderate solubility in organic solvents and limited solubility in water, depending on the presence of polar functional groups. The carboxylic acid group can participate in hydrogen bonding, affecting its acidity and potential as a ligand in coordination chemistry. Additionally, the presence of the aromatic dimethylbenzoyl moiety may impart distinct electronic properties, making it of interest in various applications, including pharmaceuticals and organic synthesis. Overall, this compound's unique structure and properties make it a subject of interest in both research and industrial contexts.
Formula:C16H20O3
InChI:InChI=1/C16H20O3/c1-10-6-5-7-11(2)14(10)15(17)12-8-3-4-9-13(12)16(18)19/h5-7,12-13H,3-4,8-9H2,1-2H3,(H,18,19)/t12-,13+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.