CAS 733742-70-6

(1R,2R)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid

Description:

(1R,2R)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid is a chiral compound characterized by its cyclohexane ring structure, which is substituted at the 1 and 2 positions. The presence of a carboxylic acid functional group (-COOH) at the 1-position contributes to its acidity and potential reactivity in various chemical reactions. The 2-(2-methylbenzoyl) substituent introduces an aromatic component, enhancing the compound's hydrophobic characteristics and influencing its solubility in organic solvents. This compound's stereochemistry, indicated by the (1R,2R) configuration, plays a crucial role in its biological activity and interactions, making it relevant in pharmaceutical applications. Additionally, the presence of the methyl group on the benzoyl moiety can affect the compound's steric and electronic properties, potentially impacting its binding affinity to biological targets. Overall, this compound's unique structural features and functional groups make it a subject of interest in organic synthesis and medicinal chemistry.

Formula: C₁₅H₁₈O₃

InChI: InChI=1/C15H18O3/c1-10-6-2-3-7-11(10)14(16)12-8-4-5-9-13(12)15(17)18/h2-3,6-7,12-13H,4-5,8-9H2,1H3,(H,17,18)/t12-,13-/m1/s1

SMILES: Cc1ccccc1C(=O)[C@@H]1CCCC[C@H]1C(=O)O