CAS 733742-73-9
:(1R,2R)-2-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid
Description:
(1R,2R)-2-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid is a chiral compound characterized by its cyclohexane ring structure, which features a carboxylic acid functional group and a methoxybenzoyl substituent. The presence of the chiral centers at the 1 and 2 positions of the cyclohexane ring imparts specific stereochemical properties, influencing its reactivity and interactions with biological systems. This compound is likely to exhibit moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic cyclohexane ring and the presence of the bulky methoxybenzoyl group. Its potential applications could span pharmaceuticals, where it may serve as an intermediate or active ingredient, particularly in the development of drugs targeting specific biological pathways. The compound's unique structure may also allow for specific interactions with enzymes or receptors, making it of interest in medicinal chemistry. As with many organic compounds, stability under various conditions, such as temperature and pH, would be essential for its practical use.
Formula:C15H18O4
InChI:InChI=1/C15H18O4/c1-19-11-6-4-5-10(9-11)14(16)12-7-2-3-8-13(12)15(17)18/h4-6,9,12-13H,2-3,7-8H2,1H3,(H,17,18)/t12-,13-/m1/s1
SMILES:COc1cccc(c1)C(=O)[C@@H]1CCCC[C@H]1C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.